About N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide
N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide (PubChem CID 18735515) has the molecular formula C20H35N3O
and a molecular weight of 333.52 g/mol. Its IUPAC name is N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide.
Molecular Properties
| Compound Name | N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide |
| PubChem CID | 18735515 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide |
| SMILES | CCCc1cncnc1N(C(=O)CC(C)(C)C)C(CCC)CCC |
| InChI | InChI=1S/C20H35N3O/c1-7-10-16-14-21-15-22-19(16)23(17(11-8-2)12-9-3)18(24)13-20(4,5)6/h14-15,17H,7-13H2,1-6H3 |
| InChIKey | CMDIQLJUSZPNTM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide?
The IUPAC name of N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide (CID 18735515) is N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide.
What is the SMILES notation for N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide?
The canonical SMILES for N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide is CCCc1cncnc1N(C(=O)CC(C)(C)C)C(CCC)CCC.
What is the InChIKey of N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide?
The InChIKey is CMDIQLJUSZPNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N3O/c1-7-10-16-14-21-15-22-19(16)23(17(11-8-2)12-9-3)18(24)13-20(4,5)6/h14-15,17H,7-13H2,1-6H3.
What are the key properties of N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide?
N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide has a molecular weight of 333.52 g/mol, XLogP of 5.17, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-4-yl-3,3-dimethyl-N-(5-propylpyrimidin-4-yl)butanamide is sourced from PubChem (CID 18735515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).