About 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol
3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol (PubChem CID 18735590) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol |
| PubChem CID | 18735590 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol |
| SMILES | C=C1NC(C)C(C(C)(C)C)=C1O |
| InChI | InChI=1S/C10H17NO/c1-6-8(10(3,4)5)9(12)7(2)11-6/h6,11-12H,2H2,1,3-5H3 |
| InChIKey | VCOJFOADYZXWLB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol?
The IUPAC name of 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol (CID 18735590) is 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol.
What is the SMILES notation for 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol?
The canonical SMILES for 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol is C=C1NC(C)C(C(C)(C)C)=C1O.
What is the InChIKey of 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol?
The InChIKey is VCOJFOADYZXWLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-6-8(10(3,4)5)9(12)7(2)11-6/h6,11-12H,2H2,1,3-5H3.
What are the key properties of 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol?
3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol has a molecular weight of 167.25 g/mol, XLogP of 2.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-methyl-5-methylidene-1,2-dihydropyrrol-4-ol is sourced from PubChem (CID 18735590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).