C14H26F5NO3S — CID 18735740
N-(3,3-dimethylbutyl)-2-(2,2,3,3,3-pentafluoropropoxy)-N-propylethanesulfonamide (PubChem CID 18735740) has the molecular formula C14H26F5NO3S and a molecular weight of 383.42 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2-(2,2,3,3,3-pentafluoropropoxy)-N-propylethanesulfonamide.
| Compound Name | N-(3,3-dimethylbutyl)-2-(2,2,3,3,3-pentafluoropropoxy)-N-propylethanesulfonamide |
|---|---|
| PubChem CID | 18735740 |
| Molecular Formula | C14H26F5NO3S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2-(2,2,3,3,3-pentafluoropropoxy)-N-propylethanesulfonamide |
| SMILES | CCCN(CCC(C)(C)C)S(=O)(=O)CCOCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H26F5NO3S/c1-5-7-20(8-6-12(2,3)4)24(21,22)10-9-23-11-13(15,16)14(17,18)19/h5-11H2,1-4H3 |
| InChIKey | DFQGOXHJSGVKQB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|