C12H22F5NO2S — CID 18735744
N-(3,3-dimethylbutyl)-2,2,3,3,3-pentafluoro-N-propan-2-ylpropane-1-sulfonamide (PubChem CID 18735744) has the molecular formula C12H22F5NO2S and a molecular weight of 339.37 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2,2,3,3,3-pentafluoro-N-propan-2-ylpropane-1-sulfonamide.
| Compound Name | N-(3,3-dimethylbutyl)-2,2,3,3,3-pentafluoro-N-propan-2-ylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 18735744 |
| Molecular Formula | C12H22F5NO2S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2,2,3,3,3-pentafluoro-N-propan-2-ylpropane-1-sulfonamide |
| SMILES | CC(C)N(CCC(C)(C)C)S(=O)(=O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H22F5NO2S/c1-9(2)18(7-6-10(3,4)5)21(19,20)8-11(13,14)12(15,16)17/h9H,6-8H2,1-5H3 |
| InChIKey | PVACOMHVUHSRGK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|