About N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine
N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine (PubChem CID 18735766) has the molecular formula C16H28FN3
and a molecular weight of 281.42 g/mol. Its IUPAC name is N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine |
| PubChem CID | 18735766 |
| Molecular Formula | C16H28FN3 |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine |
| SMILES | CCc1nc(N(CCC(C)(C)C)C(C)CC)ncc1F |
| InChI | InChI=1S/C16H28FN3/c1-7-12(3)20(10-9-16(4,5)6)15-18-11-13(17)14(8-2)19-15/h11-12H,7-10H2,1-6H3 |
| InChIKey | PPZAWLRFGJXXGT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine?
The IUPAC name of N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine (CID 18735766) is N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine.
What is the SMILES notation for N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine?
The canonical SMILES for N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine is CCc1nc(N(CCC(C)(C)C)C(C)CC)ncc1F.
What is the InChIKey of N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine?
The InChIKey is PPZAWLRFGJXXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28FN3/c1-7-12(3)20(10-9-16(4,5)6)15-18-11-13(17)14(8-2)19-15/h11-12H,7-10H2,1-6H3.
What are the key properties of N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine?
N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine has a molecular weight of 281.42 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N-(3,3-dimethylbutyl)-4-ethyl-5-fluoropyrimidin-2-amine is sourced from PubChem (CID 18735766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).