C14H28F3NO3S — CID 18735819
N-(3,3-dimethylbutyl)-N-(2-methylpropyl)-2-(2,2,2-trifluoroethoxy)ethanesulfonamide (PubChem CID 18735819) has the molecular formula C14H28F3NO3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-N-(2-methylpropyl)-2-(2,2,2-trifluoroethoxy)ethanesulfonamide.
| Compound Name | N-(3,3-dimethylbutyl)-N-(2-methylpropyl)-2-(2,2,2-trifluoroethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 18735819 |
| Molecular Formula | C14H28F3NO3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(3,3-dimethylbutyl)-N-(2-methylpropyl)-2-(2,2,2-trifluoroethoxy)ethanesulfonamide |
| SMILES | CC(C)CN(CCC(C)(C)C)S(=O)(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C14H28F3NO3S/c1-12(2)10-18(7-6-13(3,4)5)22(19,20)9-8-21-11-14(15,16)17/h12H,6-11H2,1-5H3 |
| InChIKey | ZDFVQVXYSULLCF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|