About N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide
N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide (PubChem CID 18735821) has the molecular formula C14H31NO2S
and a molecular weight of 277.47 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide |
| PubChem CID | 18735821 |
| Molecular Formula | C14H31NO2S |
| Molecular Weight | 277.47 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide |
| SMILES | CC(C)CN(CCC(C)(C)C)S(=O)(=O)CC(C)C |
| InChI | InChI=1S/C14H31NO2S/c1-12(2)10-15(9-8-14(5,6)7)18(16,17)11-13(3)4/h12-13H,8-11H2,1-7H3 |
| InChIKey | GZEZJVBVQQXVPB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide?
The IUPAC name of N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide (CID 18735821) is N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide.
What is the SMILES notation for N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide?
The canonical SMILES for N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide is CC(C)CN(CCC(C)(C)C)S(=O)(=O)CC(C)C.
What is the InChIKey of N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide?
The InChIKey is GZEZJVBVQQXVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO2S/c1-12(2)10-15(9-8-14(5,6)7)18(16,17)11-13(3)4/h12-13H,8-11H2,1-7H3.
What are the key properties of N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide?
N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide has a molecular weight of 277.47 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutyl)-2-methyl-N-(2-methylpropyl)propane-1-sulfonamide is sourced from PubChem (CID 18735821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).