C14H28F3NO3S — CID 18736072
N-butyl-N-(3,3-dimethylbutyl)-2-(2,2,2-trifluoroethoxy)ethanesulfonamide (PubChem CID 18736072) has the molecular formula C14H28F3NO3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-butyl-N-(3,3-dimethylbutyl)-2-(2,2,2-trifluoroethoxy)ethanesulfonamide.
| Compound Name | N-butyl-N-(3,3-dimethylbutyl)-2-(2,2,2-trifluoroethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 18736072 |
| Molecular Formula | C14H28F3NO3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-butyl-N-(3,3-dimethylbutyl)-2-(2,2,2-trifluoroethoxy)ethanesulfonamide |
| SMILES | CCCCN(CCC(C)(C)C)S(=O)(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C14H28F3NO3S/c1-5-6-8-18(9-7-13(2,3)4)22(19,20)11-10-21-12-14(15,16)17/h5-12H2,1-4H3 |
| InChIKey | OXVCREGUDLEHMS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|