About N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide
N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide (PubChem CID 18736105) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide |
| PubChem CID | 18736105 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide |
| SMILES | CCCCN(CCC(C)(C)C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H32N2O/c1-5-6-11-18(14-10-16(2,3)4)15(19)17-12-8-7-9-13-17/h5-14H2,1-4H3 |
| InChIKey | XOFMYPACXQFTAE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide?
The IUPAC name of N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide (CID 18736105) is N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide.
What is the SMILES notation for N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide?
The canonical SMILES for N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide is CCCCN(CCC(C)(C)C)C(=O)N1CCCCC1.
What is the InChIKey of N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide?
The InChIKey is XOFMYPACXQFTAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O/c1-5-6-11-18(14-10-16(2,3)4)15(19)17-12-8-7-9-13-17/h5-14H2,1-4H3.
What are the key properties of N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide?
N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide has a molecular weight of 268.44 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(3,3-dimethylbutyl)piperidine-1-carboxamide is sourced from PubChem (CID 18736105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).