About N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide
N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide (PubChem CID 18736106) has the molecular formula C13H29NO2S
and a molecular weight of 263.45 g/mol. Its IUPAC name is N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide |
| PubChem CID | 18736106 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide |
| SMILES | CCCCN(CCC(C)(C)C)S(=O)(=O)CCC |
| InChI | InChI=1S/C13H29NO2S/c1-6-8-10-14(11-9-13(3,4)5)17(15,16)12-7-2/h6-12H2,1-5H3 |
| InChIKey | DYDCEPSVHAXXHN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide?
The IUPAC name of N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide (CID 18736106) is N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide.
What is the SMILES notation for N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide?
The canonical SMILES for N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide is CCCCN(CCC(C)(C)C)S(=O)(=O)CCC.
What is the InChIKey of N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide?
The InChIKey is DYDCEPSVHAXXHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO2S/c1-6-8-10-14(11-9-13(3,4)5)17(15,16)12-7-2/h6-12H2,1-5H3.
What are the key properties of N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide?
N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide has a molecular weight of 263.45 g/mol, XLogP of 3.26, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(3,3-dimethylbutyl)propane-1-sulfonamide is sourced from PubChem (CID 18736106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).