C22H46N4 — CID 18736408
N'-methyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)methanediamine (PubChem CID 18736408) has the molecular formula C22H46N4 and a molecular weight of 366.64 g/mol. Its IUPAC name is N'-methyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)methanediamine.
| Compound Name | N'-methyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)methanediamine |
|---|---|
| PubChem CID | 18736408 |
| Molecular Formula | C22H46N4 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.37 |
| IUPAC Name | N'-methyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)methanediamine |
| SMILES | CN(CNC1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C22H46N4/c1-19(2)12-17(13-20(3,4)25(19)10)23-16-24(9)18-14-21(5,6)26(11)22(7,8)15-18/h17-18,23H,12-16H2,1-11H3 |
| InChIKey | ZIMAPQMZXNWZMB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|