About [dimethyl(propyl)silyl] tripropyl silicate
[dimethyl(propyl)silyl] tripropyl silicate (PubChem CID 18736421) has the molecular formula C14H34O4Si2
and a molecular weight of 322.59 g/mol. Its IUPAC name is [dimethyl(propyl)silyl] tripropyl silicate.
Molecular Properties
| Compound Name | [dimethyl(propyl)silyl] tripropyl silicate |
| PubChem CID | 18736421 |
| Molecular Formula | C14H34O4Si2 |
| Molecular Weight | 322.59 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | [dimethyl(propyl)silyl] tripropyl silicate |
| SMILES | CCCO[Si](OCCC)(OCCC)O[Si](C)(C)CCC |
| InChI | InChI=1S/C14H34O4Si2/c1-7-11-15-20(16-12-8-2,17-13-9-3)18-19(5,6)14-10-4/h7-14H2,1-6H3 |
| InChIKey | SURXJZGTEUYJCT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(propyl)silyl] tripropyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(propyl)silyl] tripropyl silicate?
The IUPAC name of [dimethyl(propyl)silyl] tripropyl silicate (CID 18736421) is [dimethyl(propyl)silyl] tripropyl silicate.
What is the SMILES notation for [dimethyl(propyl)silyl] tripropyl silicate?
The canonical SMILES for [dimethyl(propyl)silyl] tripropyl silicate is CCCO[Si](OCCC)(OCCC)O[Si](C)(C)CCC.
What is the InChIKey of [dimethyl(propyl)silyl] tripropyl silicate?
The InChIKey is SURXJZGTEUYJCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H34O4Si2/c1-7-11-15-20(16-12-8-2,17-13-9-3)18-19(5,6)14-10-4/h7-14H2,1-6H3.
What are the key properties of [dimethyl(propyl)silyl] tripropyl silicate?
[dimethyl(propyl)silyl] tripropyl silicate has a molecular weight of 322.59 g/mol, XLogP of 4.33, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(propyl)silyl] tripropyl silicate is sourced from PubChem (CID 18736421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).