About CID 18736445
CID 18736445 (PubChem CID 18736445) has the molecular formula C30H50O2Si3
and a molecular weight of 526.99 g/mol.
Molecular Properties
| Compound Name | CID 18736445 |
| PubChem CID | 18736445 |
| Molecular Formula | C30H50O2Si3 |
| Molecular Weight | 526.99 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC1CC2C=CC=CC2C1[Si](C)(C)C1C(O[Si](C)(C)C(C)(C)C)CC2C=CC=CC21 |
| InChI | InChI=1S/C30H50O2Si3/c1-29(2,3)33-31-25-19-21-15-11-13-17-23(21)27(25)34(7,8)28-24-18-14-12-16-22(24)20-26(28)32-35(9,10)30(4,5)6/h11-18,21-28H,19-20H2,1-10H3 |
| InChIKey | JHIGZJKMGKPMGX-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.99 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18736445 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18736445?
The IUPAC name of CID 18736445 (CID 18736445) is not available.
What is the SMILES notation for CID 18736445?
The canonical SMILES for CID 18736445 is CC(C)(C)[Si]OC1CC2C=CC=CC2C1[Si](C)(C)C1C(O[Si](C)(C)C(C)(C)C)CC2C=CC=CC21.
What is the InChIKey of CID 18736445?
The InChIKey is JHIGZJKMGKPMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H50O2Si3/c1-29(2,3)33-31-25-19-21-15-11-13-17-23(21)27(25)34(7,8)28-24-18-14-12-16-22(24)20-26(28)32-35(9,10)30(4,5)6/h11-18,21-28H,19-20H2,1-10H3.
What are the key properties of CID 18736445?
CID 18736445 has a molecular weight of 526.99 g/mol, XLogP of 8.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18736445 is sourced from PubChem (CID 18736445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).