About 4,5,6-trimethylpyrimidine
4,5,6-trimethylpyrimidine (PubChem CID 18736669) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 4,5,6-trimethylpyrimidine.
Molecular Properties
| Compound Name | 4,5,6-trimethylpyrimidine |
| PubChem CID | 18736669 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4,5,6-trimethylpyrimidine |
| SMILES | Cc1ncnc(C)c1C |
| InChI | InChI=1S/C7H10N2/c1-5-6(2)8-4-9-7(5)3/h4H,1-3H3 |
| InChIKey | HLTWPEDCRAMGSW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5,6-trimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6-trimethylpyrimidine?
The IUPAC name of 4,5,6-trimethylpyrimidine (CID 18736669) is 4,5,6-trimethylpyrimidine.
What is the SMILES notation for 4,5,6-trimethylpyrimidine?
The canonical SMILES for 4,5,6-trimethylpyrimidine is Cc1ncnc(C)c1C.
What is the InChIKey of 4,5,6-trimethylpyrimidine?
The InChIKey is HLTWPEDCRAMGSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-5-6(2)8-4-9-7(5)3/h4H,1-3H3.
What are the key properties of 4,5,6-trimethylpyrimidine?
4,5,6-trimethylpyrimidine has a molecular weight of 122.17 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6-trimethylpyrimidine is sourced from PubChem (CID 18736669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).