C30H36N6O6 — CID 18737106
2-N,4-N,6-N-tris(2,5-dimethoxy-4-methylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 18737106) has the molecular formula C30H36N6O6 and a molecular weight of 576.65 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(2,5-dimethoxy-4-methylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(2,5-dimethoxy-4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 18737106 |
| Molecular Formula | C30H36N6O6 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 2-N,4-N,6-N-tris(2,5-dimethoxy-4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1cc(Nc2nc(Nc3cc(OC)c(C)cc3OC)nc(Nc3cc(OC)c(C)cc3OC)n2)c(OC)cc1C |
| InChI | InChI=1S/C30H36N6O6/c1-16-10-25(40-7)19(13-22(16)37-4)31-28-34-29(32-20-14-23(38-5)17(2)11-26(20)41-8)36-30(35-28)33-21-15-24(39-6)18(3)12-27(21)42-9/h10-15H,1-9H3,(H3,31,32,33,34,35,36) |
| InChIKey | CBVNNVGGXLHEGE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |