C27H30N6O6 — CID 18737109
2-N,4-N,6-N-tris(3,4-dimethoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 18737109) has the molecular formula C27H30N6O6 and a molecular weight of 534.57 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(3,4-dimethoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(3,4-dimethoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 18737109 |
| Molecular Formula | C27H30N6O6 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 2-N,4-N,6-N-tris(3,4-dimethoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(Nc2nc(Nc3ccc(OC)c(OC)c3)nc(Nc3ccc(OC)c(OC)c3)n2)cc1OC |
| InChI | InChI=1S/C27H30N6O6/c1-34-19-10-7-16(13-22(19)37-4)28-25-31-26(29-17-8-11-20(35-2)23(14-17)38-5)33-27(32-25)30-18-9-12-21(36-3)24(15-18)39-6/h7-15H,1-6H3,(H3,28,29,30,31,32,33) |
| InChIKey | DMOAVQGHXVWYCE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |