C8H14O2S — CID 18737117
5,7-dimethyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxine (PubChem CID 18737117) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is 5,7-dimethyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-dimethyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 18737117 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 5,7-dimethyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]dioxine |
| SMILES | CC1SC(C)C2OCCOC12 |
| InChI | InChI=1S/C8H14O2S/c1-5-7-8(6(2)11-5)10-4-3-9-7/h5-8H,3-4H2,1-2H3 |
| InChIKey | YMQGVZKGGMLYNA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |