About 1,4,5-trimethyl-2,3-dihydropyrrole
1,4,5-trimethyl-2,3-dihydropyrrole (PubChem CID 18737135) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is 1,4,5-trimethyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 1,4,5-trimethyl-2,3-dihydropyrrole |
| PubChem CID | 18737135 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | 1,4,5-trimethyl-2,3-dihydropyrrole |
| SMILES | CC1=C(C)N(C)CC1 |
| InChI | InChI=1S/C7H13N/c1-6-4-5-8(3)7(6)2/h4-5H2,1-3H3 |
| InChIKey | MMYDWGXXYJMKCM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4,5-trimethyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5-trimethyl-2,3-dihydropyrrole?
The IUPAC name of 1,4,5-trimethyl-2,3-dihydropyrrole (CID 18737135) is 1,4,5-trimethyl-2,3-dihydropyrrole.
What is the SMILES notation for 1,4,5-trimethyl-2,3-dihydropyrrole?
The canonical SMILES for 1,4,5-trimethyl-2,3-dihydropyrrole is CC1=C(C)N(C)CC1.
What is the InChIKey of 1,4,5-trimethyl-2,3-dihydropyrrole?
The InChIKey is MMYDWGXXYJMKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N/c1-6-4-5-8(3)7(6)2/h4-5H2,1-3H3.
What are the key properties of 1,4,5-trimethyl-2,3-dihydropyrrole?
1,4,5-trimethyl-2,3-dihydropyrrole has a molecular weight of 111.19 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5-trimethyl-2,3-dihydropyrrole is sourced from PubChem (CID 18737135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).