About 1-methoxy-4,5-dimethyltriazole
1-methoxy-4,5-dimethyltriazole (PubChem CID 18737148) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 1-methoxy-4,5-dimethyltriazole.
Molecular Properties
| Compound Name | 1-methoxy-4,5-dimethyltriazole |
| PubChem CID | 18737148 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 1-methoxy-4,5-dimethyltriazole |
| SMILES | COn1nnc(C)c1C |
| InChI | InChI=1S/C5H9N3O/c1-4-5(2)8(9-3)7-6-4/h1-3H3 |
| InChIKey | MGUUEHKXWCKTSV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxy-4,5-dimethyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4,5-dimethyltriazole?
The IUPAC name of 1-methoxy-4,5-dimethyltriazole (CID 18737148) is 1-methoxy-4,5-dimethyltriazole.
What is the SMILES notation for 1-methoxy-4,5-dimethyltriazole?
The canonical SMILES for 1-methoxy-4,5-dimethyltriazole is COn1nnc(C)c1C.
What is the InChIKey of 1-methoxy-4,5-dimethyltriazole?
The InChIKey is MGUUEHKXWCKTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-4-5(2)8(9-3)7-6-4/h1-3H3.
What are the key properties of 1-methoxy-4,5-dimethyltriazole?
1-methoxy-4,5-dimethyltriazole has a molecular weight of 127.15 g/mol, XLogP of -0.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4,5-dimethyltriazole is sourced from PubChem (CID 18737148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).