About triazolo[4,5-b]pyridin-3-yl acetate
triazolo[4,5-b]pyridin-3-yl acetate (PubChem CID 18737155) has the molecular formula C7H6N4O2
and a molecular weight of 178.15 g/mol. Its IUPAC name is triazolo[4,5-b]pyridin-3-yl acetate.
Molecular Properties
| Compound Name | triazolo[4,5-b]pyridin-3-yl acetate |
| PubChem CID | 18737155 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | triazolo[4,5-b]pyridin-3-yl acetate |
| SMILES | CC(=O)On1nnc2cccnc21 |
| InChI | InChI=1S/C7H6N4O2/c1-5(12)13-11-7-6(9-10-11)3-2-4-8-7/h2-4H,1H3 |
| InChIKey | DGHKOLVLZJLHAG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze triazolo[4,5-b]pyridin-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazolo[4,5-b]pyridin-3-yl acetate?
The IUPAC name of triazolo[4,5-b]pyridin-3-yl acetate (CID 18737155) is triazolo[4,5-b]pyridin-3-yl acetate.
What is the SMILES notation for triazolo[4,5-b]pyridin-3-yl acetate?
The canonical SMILES for triazolo[4,5-b]pyridin-3-yl acetate is CC(=O)On1nnc2cccnc21.
What is the InChIKey of triazolo[4,5-b]pyridin-3-yl acetate?
The InChIKey is DGHKOLVLZJLHAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c1-5(12)13-11-7-6(9-10-11)3-2-4-8-7/h2-4H,1H3.
What are the key properties of triazolo[4,5-b]pyridin-3-yl acetate?
triazolo[4,5-b]pyridin-3-yl acetate has a molecular weight of 178.15 g/mol, XLogP of -0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[4,5-b]pyridin-3-yl acetate is sourced from PubChem (CID 18737155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).