C5H2F8O — CID 18737302
2,2,3,3,5,5,6,6-octafluorooxane (PubChem CID 18737302) has the molecular formula C5H2F8O and a molecular weight of 230.05 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluorooxane.
| Compound Name | 2,2,3,3,5,5,6,6-octafluorooxane |
|---|---|
| PubChem CID | 18737302 |
| Molecular Formula | C5H2F8O |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluorooxane |
| SMILES | FC1(F)CC(F)(F)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C5H2F8O/c6-2(7)1-3(8,9)5(12,13)14-4(2,10)11/h1H2 |
| InChIKey | QWPIFHPCVAYQIG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|