C25H30F6 — CID 18737363
1-[1,1,1,3,3,3-hexafluoro-2-(2,3,4,5,6-pentamethylphenyl)propan-2-yl]-2,3,4,5,6-pentamethylbenzene (PubChem CID 18737363) has the molecular formula C25H30F6 and a molecular weight of 444.50 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-(2,3,4,5,6-pentamethylphenyl)propan-2-yl]-2,3,4,5,6-pentamethylbenzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-(2,3,4,5,6-pentamethylphenyl)propan-2-yl]-2,3,4,5,6-pentamethylbenzene |
|---|---|
| PubChem CID | 18737363 |
| Molecular Formula | C25H30F6 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-(2,3,4,5,6-pentamethylphenyl)propan-2-yl]-2,3,4,5,6-pentamethylbenzene |
| SMILES | Cc1c(C)c(C)c(C(c2c(C)c(C)c(C)c(C)c2C)(C(F)(F)F)C(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C25H30F6/c1-11-13(3)17(7)21(18(8)14(11)4)23(24(26,27)28,25(29,30)31)22-19(9)15(5)12(2)16(6)20(22)10/h1-10H3 |
| InChIKey | OQWSVZRXOKJSAG-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |