C14H16O4 — CID 18738566
(5aR,6R)-6-hydroxy-3,5a-dimethyl-6,7,8,9-tetrahydropyrano[4,3-b]chromen-1-one (PubChem CID 18738566) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (5aR,6R)-6-hydroxy-3,5a-dimethyl-6,7,8,9-tetrahydropyrano[4,3-b]chromen-1-one.
| Compound Name | (5aR,6R)-6-hydroxy-3,5a-dimethyl-6,7,8,9-tetrahydropyrano[4,3-b]chromen-1-one |
|---|---|
| PubChem CID | 18738566 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (5aR,6R)-6-hydroxy-3,5a-dimethyl-6,7,8,9-tetrahydropyrano[4,3-b]chromen-1-one |
| SMILES | Cc1cc2c(c(=O)o1)C=C1CCC[C@@H](O)[C@]1(C)O2 |
| InChI | InChI=1S/C14H16O4/c1-8-6-11-10(13(16)17-8)7-9-4-3-5-12(15)14(9,2)18-11/h6-7,12,15H,3-5H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | UXFXMKUYHBVCOJ-TZMCWYRMSA-N |
| XLogP | 2.03 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |