C21H25N3 — CID 18738599
4-(2,8,9-trimethyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)aniline (PubChem CID 18738599) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-(2,8,9-trimethyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)aniline.
| Compound Name | 4-(2,8,9-trimethyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)aniline |
|---|---|
| PubChem CID | 18738599 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 4-(2,8,9-trimethyl-3,4,4a,10b-tetrahydro-1H-benzo[c][1,6]naphthyridin-6-yl)aniline |
| SMILES | Cc1cc2c(cc1C)C1CN(C)CCC1N=C2c1ccc(N)cc1 |
| InChI | InChI=1S/C21H25N3/c1-13-10-17-18(11-14(13)2)21(15-4-6-16(22)7-5-15)23-20-8-9-24(3)12-19(17)20/h4-7,10-11,19-20H,8-9,12,22H2,1-3H3 |
| InChIKey | GDAPDFUBXRJACK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|