C16H18N2Y+ — CID 18738653
ethane;5,6,7,8-tetramethyl-4H-quinolin-4-ide-3-carbonitrile;yttrium(3+) (PubChem CID 18738653) has the molecular formula C16H18N2Y+ and a molecular weight of 327.24 g/mol. Its IUPAC name is ethane;5,6,7,8-tetramethyl-4H-quinolin-4-ide-3-carbonitrile;yttrium(3+).
| Compound Name | ethane;5,6,7,8-tetramethyl-4H-quinolin-4-ide-3-carbonitrile;yttrium(3+) |
|---|---|
| PubChem CID | 18738653 |
| Molecular Formula | C16H18N2Y+ |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | ethane;5,6,7,8-tetramethyl-4H-quinolin-4-ide-3-carbonitrile;yttrium(3+) |
| SMILES | Cc1c(C)c(C)c2ncc(C#N)[c-]c2c1C.[CH2-]C.[Y+3] |
| InChI | InChI=1S/C14H13N2.C2H5.Y/c1-8-9(2)11(4)14-13(10(8)3)5-12(6-15)7-16-14;1-2;/h7H,1-4H3;1H2,2H3;/q2*-1;+3 |
| InChIKey | FFFXJERKPFLEIS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|