C14H10Cl3NO — CID 18739044
4-methyl-N-(3,4,5-trichlorophenyl)benzamide (PubChem CID 18739044) has the molecular formula C14H10Cl3NO and a molecular weight of 314.60 g/mol. Its IUPAC name is 4-methyl-N-(3,4,5-trichlorophenyl)benzamide.
| Compound Name | 4-methyl-N-(3,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 18739044 |
| Molecular Formula | C14H10Cl3NO |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 4-methyl-N-(3,4,5-trichlorophenyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(Cl)c(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H10Cl3NO/c1-8-2-4-9(5-3-8)14(19)18-10-6-11(15)13(17)12(16)7-10/h2-7H,1H3,(H,18,19) |
| InChIKey | ZTXHBUAUQGCLQR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|