C13H12F12O2 — CID 18739193
(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-2-methyloctan-2-yl) 2-methylprop-2-enoate (PubChem CID 18739193) has the molecular formula C13H12F12O2 and a molecular weight of 428.21 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-2-methyloctan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-2-methyloctan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18739193 |
| Molecular Formula | C13H12F12O2 |
| Molecular Weight | 428.21 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-2-methyloctan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H12F12O2/c1-5(2)6(26)27-8(3,4)10(18,19)12(22,23)13(24,25)11(20,21)9(16,17)7(14)15/h7H,1H2,2-4H3 |
| InChIKey | VYRFTWORPMABCB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|