C22H42O2 — CID 18739245
[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl] 2-methylprop-2-enoate (PubChem CID 18739245) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is [2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl] 2-methylprop-2-enoate.
| Compound Name | [2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18739245 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | [2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCC(C)CC(C)(C)C)C(C)CC(C)(C)C |
| InChI | InChI=1S/C22H42O2/c1-16(2)20(23)24-15-19(18(4)14-22(8,9)10)12-11-17(3)13-21(5,6)7/h17-19H,1,11-15H2,2-10H3 |
| InChIKey | VAZNQVXUFWTAMM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|