About methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate
methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate (PubChem CID 18739332) has the molecular formula C24H24O9
and a molecular weight of 456.45 g/mol. Its IUPAC name is methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate.
Molecular Properties
| Compound Name | methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate |
| PubChem CID | 18739332 |
| Molecular Formula | C24H24O9 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate |
| SMILES | COC(=O)COc1ccc2c(OCC(=O)OC)c3cc(C)ccc3cc2c1OCC(=O)OC |
| InChI | InChI=1S/C24H24O9/c1-14-5-6-15-10-18-16(23(17(15)9-14)32-12-21(26)29-3)7-8-19(31-11-20(25)28-2)24(18)33-13-22(27)30-4/h5-10H,11-13H2,1-4H3 |
| InChIKey | QVCPBOLSTWKLCK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate?
The IUPAC name of methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate (CID 18739332) is methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate.
What is the SMILES notation for methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate?
The canonical SMILES for methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate is COC(=O)COc1ccc2c(OCC(=O)OC)c3cc(C)ccc3cc2c1OCC(=O)OC.
What is the InChIKey of methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate?
The InChIKey is QVCPBOLSTWKLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O9/c1-14-5-6-15-10-18-16(23(17(15)9-14)32-12-21(26)29-3)7-8-19(31-11-20(25)28-2)24(18)33-13-22(27)30-4/h5-10H,11-13H2,1-4H3.
What are the key properties of methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate?
methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate has a molecular weight of 456.45 g/mol, XLogP of 2.96, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1,10-bis(2-methoxy-2-oxoethoxy)-6-methylanthracen-2-yl]oxyacetate is sourced from PubChem (CID 18739332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).