C24H27ClN4O3 — CID 18739487
(2,4,6-trimethylcyclohexyl) 5-chloro-6-isocyano-2-(2-methoxy-4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 18739487) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-chloro-6-isocyano-2-(2-methoxy-4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-chloro-6-isocyano-2-(2-methoxy-4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 18739487 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-chloro-6-isocyano-2-(2-methoxy-4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3ccc(C)cc3OC)[nH]n2c1Cl |
| InChI | InChI=1S/C24H27ClN4O3/c1-12-7-8-16(17(11-12)31-6)22-27-23-18(19(26-5)21(25)29(23)28-22)24(30)32-20-14(3)9-13(2)10-15(20)4/h7-8,11,13-15,20H,9-10H2,1-4,6H3,(H,27,28) |
| InChIKey | MEDDIEHEGAJCHV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|