About potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate
potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate (PubChem CID 18739521) has the molecular formula C8H10KN3O4
and a molecular weight of 251.28 g/mol. Its IUPAC name is potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate.
Molecular Properties
| Compound Name | potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate |
| PubChem CID | 18739521 |
| Molecular Formula | C8H10KN3O4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate |
| SMILES | CCOC(=O)Cc1n[nH]c(CC(=O)[O-])n1.[K+] |
| InChI | InChI=1S/C8H11N3O4.K/c1-2-15-8(14)4-6-9-5(10-11-6)3-7(12)13;/h2-4H2,1H3,(H,12,13)(H,9,10,11);/q;+1/p-1 |
| InChIKey | IALDLMURAKECTL-UHFFFAOYSA-M |
| XLogP | -4.79 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate?
The IUPAC name of potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate (CID 18739521) is potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate.
What is the SMILES notation for potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate?
The canonical SMILES for potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate is CCOC(=O)Cc1n[nH]c(CC(=O)[O-])n1.[K+].
What is the InChIKey of potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate?
The InChIKey is IALDLMURAKECTL-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11N3O4.K/c1-2-15-8(14)4-6-9-5(10-11-6)3-7(12)13;/h2-4H2,1H3,(H,12,13)(H,9,10,11);/q;+1/p-1.
What are the key properties of potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate?
potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate has a molecular weight of 251.28 g/mol, XLogP of -4.79, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-[3-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-5-yl]acetate is sourced from PubChem (CID 18739521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).