About 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid
2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid (PubChem CID 18739523) has the molecular formula C9H13N3O4
and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid |
| PubChem CID | 18739523 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid |
| SMILES | CCOC(=O)Cc1nc(C(C)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C9H13N3O4/c1-3-16-7(13)4-6-10-8(12-11-6)5(2)9(14)15/h5H,3-4H2,1-2H3,(H,14,15)(H,10,11,12) |
| InChIKey | QXAXTXGBUGDOFK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid?
The IUPAC name of 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid (CID 18739523) is 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid.
What is the SMILES notation for 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid?
The canonical SMILES for 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid is CCOC(=O)Cc1nc(C(C)C(=O)O)n[nH]1.
What is the InChIKey of 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid?
The InChIKey is QXAXTXGBUGDOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c1-3-16-7(13)4-6-10-8(12-11-6)5(2)9(14)15/h5H,3-4H2,1-2H3,(H,14,15)(H,10,11,12).
What are the key properties of 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid?
2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid has a molecular weight of 227.22 g/mol, XLogP of 0.10, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoic acid is sourced from PubChem (CID 18739523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).