C9H12N3NaO4 — CID 18739524
sodium 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoate (PubChem CID 18739524) has the molecular formula C9H12N3NaO4 and a molecular weight of 249.20 g/mol. Its IUPAC name is sodium 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoate.
| Compound Name | sodium 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoate |
|---|---|
| PubChem CID | 18739524 |
| Molecular Formula | C9H12N3NaO4 |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | sodium 2-[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]propanoate |
| SMILES | CCOC(=O)Cc1nc(C(C)C(=O)[O-])n[nH]1.[Na+] |
| InChI | InChI=1S/C9H13N3O4.Na/c1-3-16-7(13)4-6-10-8(12-11-6)5(2)9(14)15;/h5H,3-4H2,1-2H3,(H,14,15)(H,10,11,12);/q;+1/p-1 |
| InChIKey | DMYKWHUJGSIJHN-UHFFFAOYSA-M |
| XLogP | -4.23 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |