C5H6KN3O2 — CID 18739525
potassium 2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate (PubChem CID 18739525) has the molecular formula C5H6KN3O2 and a molecular weight of 179.22 g/mol. Its IUPAC name is potassium 2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate.
| Compound Name | potassium 2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate |
|---|---|
| PubChem CID | 18739525 |
| Molecular Formula | C5H6KN3O2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | potassium 2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate |
| SMILES | Cc1nc(CC(=O)[O-])n[nH]1.[K+] |
| InChI | InChI=1S/C5H7N3O2.K/c1-3-6-4(8-7-3)2-5(9)10;/h2H2,1H3,(H,9,10)(H,6,7,8);/q;+1/p-1 |
| InChIKey | HSVBFAUAFBMCCB-UHFFFAOYSA-M |
| XLogP | -4.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |