C28H35N5O4 — CID 18739606
[7-[hydroperoxy-(2,4,6-trimethylcyclohexyl)methyl]-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 18739606) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is [7-[hydroperoxy-(2,4,6-trimethylcyclohexyl)methyl]-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [7-[hydroperoxy-(2,4,6-trimethylcyclohexyl)methyl]-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 18739606 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | [7-[hydroperoxy-(2,4,6-trimethylcyclohexyl)methyl]-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | [C-]#[N+]c1c(C(OO)C2C(C)CC(C)CC2C)c2nc(-c3ccc(C)cc3)[nH]n2c1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C28H35N5O4/c1-16-6-8-20(9-7-16)26-30-27-22(25(37-35)21-18(3)14-17(2)15-19(21)4)23(29-5)24(33(27)31-26)28(34)32-10-12-36-13-11-32/h6-9,17-19,21,25,35H,10-15H2,1-4H3,(H,30,31) |
| InChIKey | MYZWRGJIWVRHFT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|