C48H57N5O — CID 18739612
6-isocyano-7-[[4-methyl-2,6-bis(1-methylcyclohexyl)cyclohexyl]methyl]-2-(4-methylphenyl)-N,N-diphenyl-3H-pyrrolo[1,2-b][1,2,4]triazole-5-carboxamide (PubChem CID 18739612) has the molecular formula C48H57N5O and a molecular weight of 720.02 g/mol. Its IUPAC name is 6-isocyano-7-[[4-methyl-2,6-bis(1-methylcyclohexyl)cyclohexyl]methyl]-2-(4-methylphenyl)-N,N-diphenyl-3H-pyrrolo[1,2-b][1,2,4]triazole-5-carboxamide.
| Compound Name | 6-isocyano-7-[[4-methyl-2,6-bis(1-methylcyclohexyl)cyclohexyl]methyl]-2-(4-methylphenyl)-N,N-diphenyl-3H-pyrrolo[1,2-b][1,2,4]triazole-5-carboxamide |
|---|---|
| PubChem CID | 18739612 |
| Molecular Formula | C48H57N5O |
| Molecular Weight | 720.02 g/mol |
| Exact Mass | 719.46 |
| IUPAC Name | 6-isocyano-7-[[4-methyl-2,6-bis(1-methylcyclohexyl)cyclohexyl]methyl]-2-(4-methylphenyl)-N,N-diphenyl-3H-pyrrolo[1,2-b][1,2,4]triazole-5-carboxamide |
| SMILES | [C-]#[N+]c1c(CC2C(C3(C)CCCCC3)CC(C)CC2C2(C)CCCCC2)c2nc(-c3ccc(C)cc3)[nH]n2c1C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H57N5O/c1-33-22-24-35(25-23-33)44-50-45-39(32-38-40(47(3)26-14-8-15-27-47)30-34(2)31-41(38)48(4)28-16-9-17-29-48)42(49-5)43(53(45)51-44)46(54)52(36-18-10-6-11-19-36)37-20-12-7-13-21-37/h6-7,10-13,18-25,34,38,40-41H,8-9,14-17,26-32H2,1-4H3,(H,50,51) |
| InChIKey | VGZWCUHTCTZDAU-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.02 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|