C27H37N2O2P — CID 18739838
N-bis(2,3,4,5,6-pentamethylphenyl)phosphoryl-4,5-dimethyl-1,2-oxazol-3-amine (PubChem CID 18739838) has the molecular formula C27H37N2O2P and a molecular weight of 452.58 g/mol. Its IUPAC name is N-bis(2,3,4,5,6-pentamethylphenyl)phosphoryl-4,5-dimethyl-1,2-oxazol-3-amine.
| Compound Name | N-bis(2,3,4,5,6-pentamethylphenyl)phosphoryl-4,5-dimethyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 18739838 |
| Molecular Formula | C27H37N2O2P |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | N-bis(2,3,4,5,6-pentamethylphenyl)phosphoryl-4,5-dimethyl-1,2-oxazol-3-amine |
| SMILES | Cc1onc(NP(=O)(c2c(C)c(C)c(C)c(C)c2C)c2c(C)c(C)c(C)c(C)c2C)c1C |
| InChI | InChI=1S/C27H37N2O2P/c1-13-15(3)19(7)25(20(8)16(13)4)32(30,29-27-23(11)24(12)31-28-27)26-21(9)17(5)14(2)18(6)22(26)10/h1-12H3,(H,28,29,30) |
| InChIKey | XPDQKGFCHWQMED-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|