C24H31N3O6 — CID 18739839
1-(2,4,5-trimethylphenyl)ethyl N-[[1-(4,5-dimethyl-2-nitrophenyl)ethoxycarbonylamino]methyl]carbamate (PubChem CID 18739839) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-(2,4,5-trimethylphenyl)ethyl N-[[1-(4,5-dimethyl-2-nitrophenyl)ethoxycarbonylamino]methyl]carbamate.
| Compound Name | 1-(2,4,5-trimethylphenyl)ethyl N-[[1-(4,5-dimethyl-2-nitrophenyl)ethoxycarbonylamino]methyl]carbamate |
|---|---|
| PubChem CID | 18739839 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 1-(2,4,5-trimethylphenyl)ethyl N-[[1-(4,5-dimethyl-2-nitrophenyl)ethoxycarbonylamino]methyl]carbamate |
| SMILES | Cc1cc(C)c(C(C)OC(=O)NCNC(=O)OC(C)c2cc(C)c(C)cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C24H31N3O6/c1-13-8-17(5)20(9-14(13)2)18(6)32-23(28)25-12-26-24(29)33-19(7)21-10-15(3)16(4)11-22(21)27(30)31/h8-11,18-19H,12H2,1-7H3,(H,25,28)(H,26,29) |
| InChIKey | WXVJBWVJQKCEQB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|