About [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate
[(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate (PubChem CID 18739864) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate.
Molecular Properties
| Compound Name | [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate |
| PubChem CID | 18739864 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate |
| SMILES | C#CC(C)(C/C=C1\C(C)=CCCC1(C)C)OC(C)=O |
| InChI | InChI=1S/C17H24O2/c1-7-17(6,19-14(3)18)12-10-15-13(2)9-8-11-16(15,4)5/h1,9-10H,8,11-12H2,2-6H3/b15-10+ |
| InChIKey | MFGYNRMUEGKKHP-XNTDXEJSSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate?
The IUPAC name of [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate (CID 18739864) is [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate.
What is the SMILES notation for [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate?
The canonical SMILES for [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate is C#CC(C)(C/C=C1\C(C)=CCCC1(C)C)OC(C)=O.
What is the InChIKey of [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate?
The InChIKey is MFGYNRMUEGKKHP-XNTDXEJSSA-N. The full InChI is InChI=1S/C17H24O2/c1-7-17(6,19-14(3)18)12-10-15-13(2)9-8-11-16(15,4)5/h1,9-10H,8,11-12H2,2-6H3/b15-10+.
What are the key properties of [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate?
[(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate has a molecular weight of 260.38 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5Z)-3-methyl-5-(2,6,6-trimethylcyclohex-2-en-1-ylidene)pent-1-yn-3-yl] acetate is sourced from PubChem (CID 18739864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).