C9H18O3 — CID 18740062
1,2-dimethoxy-4-prop-2-enoxybutane (PubChem CID 18740062) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 1,2-dimethoxy-4-prop-2-enoxybutane.
| Compound Name | 1,2-dimethoxy-4-prop-2-enoxybutane |
|---|---|
| PubChem CID | 18740062 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 1,2-dimethoxy-4-prop-2-enoxybutane |
| SMILES | C=CCOCCC(COC)OC |
| InChI | InChI=1S/C9H18O3/c1-4-6-12-7-5-9(11-3)8-10-2/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | SJVPMLHHXLTKIS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|