C6H12N4 — CID 18740086
2-N,4-N,1,3-tetramethyl-1,3-diazetidine-2,4-diimine (PubChem CID 18740086) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-N,4-N,1,3-tetramethyl-1,3-diazetidine-2,4-diimine.
| Compound Name | 2-N,4-N,1,3-tetramethyl-1,3-diazetidine-2,4-diimine |
|---|---|
| PubChem CID | 18740086 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 2-N,4-N,1,3-tetramethyl-1,3-diazetidine-2,4-diimine |
| SMILES | CN=C1N(C)C(=NC)N1C |
| InChI | InChI=1S/C6H12N4/c1-7-5-9(3)6(8-2)10(5)4/h1-4H3/b7-5-,8-6+ |
| InChIKey | WPBMBHJUUSYIKL-CGXWXWIYSA-N |
| XLogP | -0.16 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|