C54H66N4O10 — CID 18740289
[4-[(3Z)-3-[2,2-bis(hexanoyloxymethyl)-1H-perimidin-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-2-(hexanoyloxymethyl)-1,3-dihydroperimidin-2-yl]methyl hexanoate (PubChem CID 18740289) has the molecular formula C54H66N4O10 and a molecular weight of 931.14 g/mol. Its IUPAC name is [4-[(3Z)-3-[2,2-bis(hexanoyloxymethyl)-1H-perimidin-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-2-(hexanoyloxymethyl)-1,3-dihydroperimidin-2-yl]methyl hexanoate.
| Compound Name | [4-[(3Z)-3-[2,2-bis(hexanoyloxymethyl)-1H-perimidin-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-2-(hexanoyloxymethyl)-1,3-dihydroperimidin-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 18740289 |
| Molecular Formula | C54H66N4O10 |
| Molecular Weight | 931.14 g/mol |
| Exact Mass | 930.48 |
| IUPAC Name | [4-[(3Z)-3-[2,2-bis(hexanoyloxymethyl)-1H-perimidin-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-2-(hexanoyloxymethyl)-1,3-dihydroperimidin-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OCC1(COC(=O)CCCCC)N=c2/c(=C3\C(=O)C(c4ccc5cccc6c5c4NC(COC(=O)CCCCC)(COC(=O)CCCCC)N6)=C3O)ccc3cccc(c23)N1 |
| InChI | InChI=1S/C54H66N4O10/c1-5-9-13-23-41(59)65-31-53(32-66-42(60)24-14-10-6-2)55-39-21-17-19-35-27-29-37(49(57-53)45(35)39)47-51(63)48(52(47)64)38-30-28-36-20-18-22-40-46(36)50(38)58-54(56-40,33-67-43(61)25-15-11-7-3)34-68-44(62)26-16-12-8-4/h17-22,27-30,55-57,63H,5-16,23-26,31-34H2,1-4H3/b48-38- |
| InChIKey | HVFSOLOJJQGQFR-DCZZXQDDSA-N |
| XLogP | 9.46 |
| TPSA | 190.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.14 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|