About (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate
(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate (PubChem CID 18740290) has the molecular formula C7H7O5-
and a molecular weight of 171.13 g/mol. Its IUPAC name is (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate.
Molecular Properties
| Compound Name | (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate |
| PubChem CID | 18740290 |
| Molecular Formula | C7H7O5- |
| Molecular Weight | 171.13 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate |
| SMILES | CC1(C)OC(=O)C(=C[O-])C(=O)O1 |
| InChI | InChI=1S/C7H8O5/c1-7(2)11-5(9)4(3-8)6(10)12-7/h3,8H,1-2H3/p-1 |
| InChIKey | DELRMBDZSMPFPS-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.13 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate?
The IUPAC name of (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate (CID 18740290) is (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate.
What is the SMILES notation for (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate?
The canonical SMILES for (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate is CC1(C)OC(=O)C(=C[O-])C(=O)O1.
What is the InChIKey of (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate?
The InChIKey is DELRMBDZSMPFPS-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O5/c1-7(2)11-5(9)4(3-8)6(10)12-7/h3,8H,1-2H3/p-1.
What are the key properties of (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate?
(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate has a molecular weight of 171.13 g/mol, XLogP of -0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methanolate is sourced from PubChem (CID 18740290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).