About (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate
(4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate (PubChem CID 18740294) has the molecular formula C9H11O3-
and a molecular weight of 167.18 g/mol. Its IUPAC name is (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate.
Molecular Properties
| Compound Name | (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate |
| PubChem CID | 18740294 |
| Molecular Formula | C9H11O3- |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate |
| SMILES | CC1(C)CC(=O)C(=C[O-])C(=O)C1 |
| InChI | InChI=1S/C9H12O3/c1-9(2)3-7(11)6(5-10)8(12)4-9/h5,10H,3-4H2,1-2H3/p-1 |
| InChIKey | IBJHHTXBSACNEB-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate?
The IUPAC name of (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate (CID 18740294) is (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate.
What is the SMILES notation for (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate?
The canonical SMILES for (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate is CC1(C)CC(=O)C(=C[O-])C(=O)C1.
What is the InChIKey of (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate?
The InChIKey is IBJHHTXBSACNEB-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12O3/c1-9(2)3-7(11)6(5-10)8(12)4-9/h5,10H,3-4H2,1-2H3/p-1.
What are the key properties of (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate?
(4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate has a molecular weight of 167.18 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-2,6-dioxocyclohexylidene)methanolate is sourced from PubChem (CID 18740294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).