C20H35N4O2P — CID 18740627
2-[[10-(dimethylphosphorylmethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]methyl]phenol (PubChem CID 18740627) has the molecular formula C20H35N4O2P and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-[[10-(dimethylphosphorylmethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]methyl]phenol.
| Compound Name | 2-[[10-(dimethylphosphorylmethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]methyl]phenol |
|---|---|
| PubChem CID | 18740627 |
| Molecular Formula | C20H35N4O2P |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-[[10-(dimethylphosphorylmethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]methyl]phenol |
| SMILES | CP(C)(=O)CN1CCN2CCN(CCN(Cc3ccccc3O)CC2)CC1 |
| InChI | InChI=1S/C20H35N4O2P/c1-27(2,26)18-24-15-11-21-7-8-22(12-16-24)10-14-23(13-9-21)17-19-5-3-4-6-20(19)25/h3-6,25H,7-18H2,1-2H3 |
| InChIKey | RECQKNRGOMSMED-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|