C26H50N6O8 — CID 18740698
methyl 2-[4-[2-[4,7-bis(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]ethyl]-7-(2-methylperoxyethyl)-1,4,7-triazonan-1-yl]acetate (PubChem CID 18740698) has the molecular formula C26H50N6O8 and a molecular weight of 574.72 g/mol. Its IUPAC name is methyl 2-[4-[2-[4,7-bis(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]ethyl]-7-(2-methylperoxyethyl)-1,4,7-triazonan-1-yl]acetate.
| Compound Name | methyl 2-[4-[2-[4,7-bis(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]ethyl]-7-(2-methylperoxyethyl)-1,4,7-triazonan-1-yl]acetate |
|---|---|
| PubChem CID | 18740698 |
| Molecular Formula | C26H50N6O8 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | methyl 2-[4-[2-[4,7-bis(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]ethyl]-7-(2-methylperoxyethyl)-1,4,7-triazonan-1-yl]acetate |
| SMILES | COOCCN1CCN(CCN2CCN(CC(=O)OC)CCN(CC(=O)OC)CC2)CCN(CC(=O)OC)CC1 |
| InChI | InChI=1S/C26H50N6O8/c1-36-24(33)21-30-13-9-27(7-8-29(12-16-30)19-20-40-39-4)5-6-28-10-14-31(22-25(34)37-2)17-18-32(15-11-28)23-26(35)38-3/h5-23H2,1-4H3 |
| InChIKey | PBEWJHFKEIYREU-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 116.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|