C16H32N4O4 — CID 18740699
methyl 2-[10-(2-methylperoxyethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]acetate (PubChem CID 18740699) has the molecular formula C16H32N4O4 and a molecular weight of 344.46 g/mol. Its IUPAC name is methyl 2-[10-(2-methylperoxyethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]acetate.
| Compound Name | methyl 2-[10-(2-methylperoxyethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]acetate |
|---|---|
| PubChem CID | 18740699 |
| Molecular Formula | C16H32N4O4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | methyl 2-[10-(2-methylperoxyethyl)-1,4,7,10-tetrazabicyclo[5.5.2]tetradecan-4-yl]acetate |
| SMILES | COOCCN1CCN2CCN(CC1)CCN(CC(=O)OC)CC2 |
| InChI | InChI=1S/C16H32N4O4/c1-22-16(21)15-20-11-9-17-3-4-18(10-12-20)6-8-19(7-5-17)13-14-24-23-2/h3-15H2,1-2H3 |
| InChIKey | NSOQUVLXYGMYBB-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 57.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|