C11H17NO — CID 18740776
1-(1-methyl-2,3,3a,4,5,7a-hexahydroindol-2-yl)ethanone (PubChem CID 18740776) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-(1-methyl-2,3,3a,4,5,7a-hexahydroindol-2-yl)ethanone.
| Compound Name | 1-(1-methyl-2,3,3a,4,5,7a-hexahydroindol-2-yl)ethanone |
|---|---|
| PubChem CID | 18740776 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-(1-methyl-2,3,3a,4,5,7a-hexahydroindol-2-yl)ethanone |
| SMILES | CC(=O)C1CC2CCC=CC2N1C |
| InChI | InChI=1S/C11H17NO/c1-8(13)11-7-9-5-3-4-6-10(9)12(11)2/h4,6,9-11H,3,5,7H2,1-2H3 |
| InChIKey | KRMFIBGSAVMPNK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|