C13H23NO — CID 18740800
1-(1-methyl-2,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[b]pyrrol-2-yl)ethanone (PubChem CID 18740800) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-(1-methyl-2,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[b]pyrrol-2-yl)ethanone.
| Compound Name | 1-(1-methyl-2,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[b]pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 18740800 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-(1-methyl-2,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[b]pyrrol-2-yl)ethanone |
| SMILES | CC(=O)C1CC2CCCCCCC2N1C |
| InChI | InChI=1S/C13H23NO/c1-10(15)13-9-11-7-5-3-4-6-8-12(11)14(13)2/h11-13H,3-9H2,1-2H3 |
| InChIKey | DELRJAYMXXTTKM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |