About 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one
5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 18740840) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
Molecular Properties
| Compound Name | 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| PubChem CID | 18740840 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CCCCN1CCn2nc(C)cc2C1=O |
| InChI | InChI=1S/C11H17N3O/c1-3-4-5-13-6-7-14-10(11(13)15)8-9(2)12-14/h8H,3-7H2,1-2H3 |
| InChIKey | TUAFJIJCIXJLRC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one?
The IUPAC name of 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (CID 18740840) is 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
What is the SMILES notation for 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one?
The canonical SMILES for 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one is CCCCN1CCn2nc(C)cc2C1=O.
What is the InChIKey of 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one?
The InChIKey is TUAFJIJCIXJLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-3-4-5-13-6-7-14-10(11(13)15)8-9(2)12-14/h8H,3-7H2,1-2H3.
What are the key properties of 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one?
5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one has a molecular weight of 207.28 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one is sourced from PubChem (CID 18740840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).